Product Description
5-Bromovanillin Compound is a pharmaceutical-grade powder with a purity level of 98%. Its molecular formula is BrC6H2-4-(OH)-3-(OCH3)CHO, and it has a melting point of 164-166C. This compound is commonly used in the pharmaceutical industry to synthesize new drugs due to its unique chemical properties. Additionally, it can be used in the food industry as a flavoring agent. The compound is stored at room temperature and has a physical form of a powder.
FAQs of 5-Bromovanillin Compound:
Q: What is 5-Bromovanillin Compound?
A: 5-Bromovanillin Compound is a pharmaceutical-grade powder that is commonly used in the pharmaceutical industry to synthesize new drugs due to its unique chemical properties.
Q: What is the purity level of this compound?
A: The purity level of 5-Bromovanillin Compound is 98%.
Q: What is the molecular formula of this compound?
A: The molecular formula of 5-Bromovanillin Compound is BrC6H2-4-(OH)-3-(OCH3)CHO.
Q: What is the storage requirement for this compound?
A: The compound is stored at room temperature.
Q: What is the physical form of this compound?
A: The physical form of 5-Bromovanillin Compound is a powder.